2-[(2-chlorophenyl)methoxy]propanoic acid

C10H11ClO3 — CID 24699510

IUPAC2-[(2-chlorophenyl)methoxy]propanoic acid
SMILESCC(OCc1ccccc1Cl)C(=O)O
InChIInChI=1S/C10H11ClO3/c1-7(10(12)13)14-6-8-4-2-3-5-9(8)11/h2-5,7H,6H2,1H3,(H,12,13)
InChIKeyUBXDCUPNBBKDEC-UHFFFAOYSA-N
MW214.65 g/mol
LogP2.33
Rot. Bonds4

About 2-[(2-chlorophenyl)methoxy]propanoic acid

2-[(2-chlorophenyl)methoxy]propanoic acid (PubChem CID 24699510) has the molecular formula C10H11ClO3 and a molecular weight of 214.65 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methoxy]propanoic acid.

Molecular Properties

Compound Name2-[(2-chlorophenyl)methoxy]propanoic acid
PubChem CID24699510
Molecular FormulaC10H11ClO3
Molecular Weight214.65 g/mol
Exact Mass214.04
IUPAC Name2-[(2-chlorophenyl)methoxy]propanoic acid
SMILESCC(OCc1ccccc1Cl)C(=O)O
InChIInChI=1S/C10H11ClO3/c1-7(10(12)13)14-6-8-4-2-3-5-9(8)11/h2-5,7H,6H2,1H3,(H,12,13)
InChIKeyUBXDCUPNBBKDEC-UHFFFAOYSA-N
XLogP2.33
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.65
LogP ≤ 52.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[(2-chlorophenyl)methoxy]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[(2-chlorophenyl)methoxy]-2-fluoroacetic acid
CID 79356366
(2S)-2-(naphthalen-1-ylmethoxy)propanoic acid
CID 104876043
(2S)-2-[(3-chloro-4-pyridinyl)methoxy]propanoic acid
CID 104876476
(2R)-2-[(2-chloro-3-fluorophenyl)methoxy]propanoic acid
CID 104875534
N-(2-aminophenyl)-2-[(2-chlorophenyl)methoxy]propanamide
CID 43110228
(2R)-3-(2-chlorophenyl)-2-methylpropanoic acid
CID 40999440
2-[2-[(2-chlorophenyl)methyl]phenyl]propanoic acid
CID 59987709
(2R)-2-[(4-phenylphenyl)methoxy]propanoic acid
CID 104875216
2-[(2-chlorophenyl)methoxy]-2-phenylacetohydrazide
CID 63588720
2-[2,3-bis[(2-chlorophenyl)methoxy]phenyl]-2-(2-methylpropanoylamino)acetic acid
CID 22258155
1-chloro-2-(2-methylpropoxymethyl)benzene
CID 123441834
2-[(2-chlorophenyl)methoxy]-6-methoxybenzoic acid
CID 170873582

Frequently Asked Questions

What is the IUPAC name of 2-[(2-chlorophenyl)methoxy]propanoic acid?
The IUPAC name of 2-[(2-chlorophenyl)methoxy]propanoic acid (CID 24699510) is 2-[(2-chlorophenyl)methoxy]propanoic acid.
What is the SMILES notation for 2-[(2-chlorophenyl)methoxy]propanoic acid?
The canonical SMILES for 2-[(2-chlorophenyl)methoxy]propanoic acid is CC(OCc1ccccc1Cl)C(=O)O.
What is the InChIKey of 2-[(2-chlorophenyl)methoxy]propanoic acid?
The InChIKey is UBXDCUPNBBKDEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO3/c1-7(10(12)13)14-6-8-4-2-3-5-9(8)11/h2-5,7H,6H2,1H3,(H,12,13).
What are the key properties of 2-[(2-chlorophenyl)methoxy]propanoic acid?
2-[(2-chlorophenyl)methoxy]propanoic acid has a molecular weight of 214.65 g/mol, XLogP of 2.33, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-chlorophenyl)methoxy]propanoic acid is sourced from PubChem (CID 24699510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).