C9H10ClNO3 — CID 104876476
(2S)-2-[(3-chloro-4-pyridinyl)methoxy]propanoic acid (PubChem CID 104876476) has the molecular formula C9H10ClNO3 and a molecular weight of 215.64 g/mol. Its IUPAC name is (2S)-2-[(3-chloro-4-pyridinyl)methoxy]propanoic acid.
| Compound Name | (2S)-2-[(3-chloro-4-pyridinyl)methoxy]propanoic acid |
|---|---|
| PubChem CID | 104876476 |
| Molecular Formula | C9H10ClNO3 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | (2S)-2-[(3-chloro-4-pyridinyl)methoxy]propanoic acid |
| SMILES | C[C@H](OCc1ccncc1Cl)C(=O)O |
| InChI | InChI=1S/C9H10ClNO3/c1-6(9(12)13)14-5-7-2-3-11-4-8(7)10/h2-4,6H,5H2,1H3,(H,12,13)/t6-/m0/s1 |
| InChIKey | VWASPDXCWSCQTE-LURJTMIESA-N |
| XLogP | 1.72 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |