C7H7ClN2O2 — CID 176952397
(3-chloro-4-pyridinyl)methylcarbamic acid (PubChem CID 176952397) has the molecular formula C7H7ClN2O2 and a molecular weight of 186.60 g/mol. Its IUPAC name is (3-chloro-4-pyridinyl)methylcarbamic acid.
| Compound Name | (3-chloro-4-pyridinyl)methylcarbamic acid |
|---|---|
| PubChem CID | 176952397 |
| Molecular Formula | C7H7ClN2O2 |
| Molecular Weight | 186.60 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | (3-chloro-4-pyridinyl)methylcarbamic acid |
| SMILES | O=C(O)NCc1ccncc1Cl |
| InChI | InChI=1S/C7H7ClN2O2/c8-6-4-9-2-1-5(6)3-10-7(11)12/h1-2,4,10H,3H2,(H,11,12) |
| InChIKey | XQNCLACFWIMEKH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.60 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |