C13H13ClFN3O2 — CID 172889058
N-[(3-chloro-4-pyridinyl)methyl]-3-fluoro-1-prop-2-enoylazetidine-3-carboxamide (PubChem CID 172889058) has the molecular formula C13H13ClFN3O2 and a molecular weight of 297.72 g/mol. Its IUPAC name is N-[(3-chloro-4-pyridinyl)methyl]-3-fluoro-1-prop-2-enoylazetidine-3-carboxamide.
| Compound Name | N-[(3-chloro-4-pyridinyl)methyl]-3-fluoro-1-prop-2-enoylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 172889058 |
| Molecular Formula | C13H13ClFN3O2 |
| Molecular Weight | 297.72 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N-[(3-chloro-4-pyridinyl)methyl]-3-fluoro-1-prop-2-enoylazetidine-3-carboxamide |
| SMILES | C=CC(=O)N1CC(F)(C(=O)NCc2ccncc2Cl)C1 |
| InChI | InChI=1S/C13H13ClFN3O2/c1-2-11(19)18-7-13(15,8-18)12(20)17-5-9-3-4-16-6-10(9)14/h2-4,6H,1,5,7-8H2,(H,17,20) |
| InChIKey | DIDKBNVDADSKQD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.72 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|