C14H14F2N2O2 — CID 172895714
3-fluoro-N-(3-fluoro-5-methylphenyl)-1-prop-2-enoylazetidine-3-carboxamide (PubChem CID 172895714) has the molecular formula C14H14F2N2O2 and a molecular weight of 280.27 g/mol. Its IUPAC name is 3-fluoro-N-(3-fluoro-5-methylphenyl)-1-prop-2-enoylazetidine-3-carboxamide.
| Compound Name | 3-fluoro-N-(3-fluoro-5-methylphenyl)-1-prop-2-enoylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 172895714 |
| Molecular Formula | C14H14F2N2O2 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 3-fluoro-N-(3-fluoro-5-methylphenyl)-1-prop-2-enoylazetidine-3-carboxamide |
| SMILES | C=CC(=O)N1CC(F)(C(=O)Nc2cc(C)cc(F)c2)C1 |
| InChI | InChI=1S/C14H14F2N2O2/c1-3-12(19)18-7-14(16,8-18)13(20)17-11-5-9(2)4-10(15)6-11/h3-6H,1,7-8H2,2H3,(H,17,20) |
| InChIKey | WGZYGZPPYJZMSN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|