C10H10ClFO3 — CID 104875534
(2R)-2-[(2-chloro-3-fluorophenyl)methoxy]propanoic acid (PubChem CID 104875534) has the molecular formula C10H10ClFO3 and a molecular weight of 232.64 g/mol. Its IUPAC name is (2R)-2-[(2-chloro-3-fluorophenyl)methoxy]propanoic acid.
| Compound Name | (2R)-2-[(2-chloro-3-fluorophenyl)methoxy]propanoic acid |
|---|---|
| PubChem CID | 104875534 |
| Molecular Formula | C10H10ClFO3 |
| Molecular Weight | 232.64 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | (2R)-2-[(2-chloro-3-fluorophenyl)methoxy]propanoic acid |
| SMILES | C[C@@H](OCc1cccc(F)c1Cl)C(=O)O |
| InChI | InChI=1S/C10H10ClFO3/c1-6(10(13)14)15-5-7-3-2-4-8(12)9(7)11/h2-4,6H,5H2,1H3,(H,13,14)/t6-/m1/s1 |
| InChIKey | IWLCQUUDQZNORL-ZCFIWIBFSA-N |
| XLogP | 2.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.64 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |