C10H22O4 — CID 3017889
1,1,5,5-tetramethoxy-2-methylpentane (PubChem CID 3017889) has the molecular formula C10H22O4 and a molecular weight of 206.28 g/mol. Its IUPAC name is 1,1,5,5-tetramethoxy-2-methylpentane.
| Compound Name | 1,1,5,5-tetramethoxy-2-methylpentane |
|---|---|
| PubChem CID | 3017889 |
| Molecular Formula | C10H22O4 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1,1,5,5-tetramethoxy-2-methylpentane |
| SMILES | COC(CCC(C)C(OC)OC)OC |
| InChI | InChI=1S/C10H22O4/c1-8(10(13-4)14-5)6-7-9(11-2)12-3/h8-10H,6-7H2,1-5H3 |
| InChIKey | JBEZZHPFGNHYEV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|