C14H30O — CID 144623899
2-methoxy-5,6,9-trimethyldecane (PubChem CID 144623899) has the molecular formula C14H30O and a molecular weight of 214.39 g/mol. Its IUPAC name is 2-methoxy-5,6,9-trimethyldecane.
| Compound Name | 2-methoxy-5,6,9-trimethyldecane |
|---|---|
| PubChem CID | 144623899 |
| Molecular Formula | C14H30O |
| Molecular Weight | 214.39 g/mol |
| Exact Mass | 214.23 |
| IUPAC Name | 2-methoxy-5,6,9-trimethyldecane |
| SMILES | COC(C)CCC(C)C(C)CCC(C)C |
| InChI | InChI=1S/C14H30O/c1-11(2)7-8-12(3)13(4)9-10-14(5)15-6/h11-14H,7-10H2,1-6H3 |
| InChIKey | FRTIBTNPRLZJTL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |