About 3-methoxybutylsilane
3-methoxybutylsilane (PubChem CID 175157864) has the molecular formula C5H14OSi
and a molecular weight of 118.25 g/mol. Its IUPAC name is 3-methoxybutylsilane.
Molecular Properties
| Compound Name | 3-methoxybutylsilane |
| PubChem CID | 175157864 |
| Molecular Formula | C5H14OSi |
| Molecular Weight | 118.25 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | 3-methoxybutylsilane |
| SMILES | COC(C)CC[SiH3] |
| InChI | InChI=1S/C5H14OSi/c1-5(6-2)3-4-7/h5H,3-4H2,1-2,7H3 |
| InChIKey | POBGJCMRMZHUNR-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxybutylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxybutylsilane?
The IUPAC name of 3-methoxybutylsilane (CID 175157864) is 3-methoxybutylsilane.
What is the SMILES notation for 3-methoxybutylsilane?
The canonical SMILES for 3-methoxybutylsilane is COC(C)CC[SiH3].
What is the InChIKey of 3-methoxybutylsilane?
The InChIKey is POBGJCMRMZHUNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14OSi/c1-5(6-2)3-4-7/h5H,3-4H2,1-2,7H3.
What are the key properties of 3-methoxybutylsilane?
3-methoxybutylsilane has a molecular weight of 118.25 g/mol, XLogP of 0.20, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxybutylsilane is sourced from PubChem (CID 175157864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).