About 4,4-dimethoxybutylsilane
4,4-dimethoxybutylsilane (PubChem CID 123239854) has the molecular formula C6H16O2Si
and a molecular weight of 148.28 g/mol. Its IUPAC name is 4,4-dimethoxybutylsilane.
Molecular Properties
| Compound Name | 4,4-dimethoxybutylsilane |
| PubChem CID | 123239854 |
| Molecular Formula | C6H16O2Si |
| Molecular Weight | 148.28 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 4,4-dimethoxybutylsilane |
| SMILES | COC(CCC[SiH3])OC |
| InChI | InChI=1S/C6H16O2Si/c1-7-6(8-2)4-3-5-9/h6H,3-5H2,1-2,9H3 |
| InChIKey | HHLGJSMVOFNAJC-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethoxybutylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethoxybutylsilane?
The IUPAC name of 4,4-dimethoxybutylsilane (CID 123239854) is 4,4-dimethoxybutylsilane.
What is the SMILES notation for 4,4-dimethoxybutylsilane?
The canonical SMILES for 4,4-dimethoxybutylsilane is COC(CCC[SiH3])OC.
What is the InChIKey of 4,4-dimethoxybutylsilane?
The InChIKey is HHLGJSMVOFNAJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O2Si/c1-7-6(8-2)4-3-5-9/h6H,3-5H2,1-2,9H3.
What are the key properties of 4,4-dimethoxybutylsilane?
4,4-dimethoxybutylsilane has a molecular weight of 148.28 g/mol, XLogP of 0.17, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethoxybutylsilane is sourced from PubChem (CID 123239854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).