C9H22O4Si — CID 87575551
(3,3-dimethoxy-2-methylpropyl)-dimethoxy-methylsilane (PubChem CID 87575551) has the molecular formula C9H22O4Si and a molecular weight of 222.36 g/mol. Its IUPAC name is (3,3-dimethoxy-2-methylpropyl)-dimethoxy-methylsilane.
| Compound Name | (3,3-dimethoxy-2-methylpropyl)-dimethoxy-methylsilane |
|---|---|
| PubChem CID | 87575551 |
| Molecular Formula | C9H22O4Si |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (3,3-dimethoxy-2-methylpropyl)-dimethoxy-methylsilane |
| SMILES | COC(OC)C(C)C[Si](C)(OC)OC |
| InChI | InChI=1S/C9H22O4Si/c1-8(9(10-2)11-3)7-14(6,12-4)13-5/h8-9H,7H2,1-6H3 |
| InChIKey | LANPXDJALJFYSA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|