C14H26O4 — CID 19816382
2,5-dimethyl-1,1-bis(prop-2-enylperoxy)hexane (PubChem CID 19816382) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is 2,5-dimethyl-1,1-bis(prop-2-enylperoxy)hexane.
| Compound Name | 2,5-dimethyl-1,1-bis(prop-2-enylperoxy)hexane |
|---|---|
| PubChem CID | 19816382 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2,5-dimethyl-1,1-bis(prop-2-enylperoxy)hexane |
| SMILES | C=CCOOC(OOCC=C)C(C)CCC(C)C |
| InChI | InChI=1S/C14H26O4/c1-6-10-15-17-14(18-16-11-7-2)13(5)9-8-12(3)4/h6-7,12-14H,1-2,8-11H2,3-5H3 |
| InChIKey | BNNSHSLAESBTKS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|