C9H19F — CID 153412007
(2S,3R)-2-(18F)fluoro-3,6-dimethylheptane (PubChem CID 153412007) has the molecular formula C9H19F and a molecular weight of 145.25 g/mol. Its IUPAC name is (2S,3R)-2-(18F)fluoro-3,6-dimethylheptane.
| Compound Name | (2S,3R)-2-(18F)fluoro-3,6-dimethylheptane |
|---|---|
| PubChem CID | 153412007 |
| Molecular Formula | C9H19F |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | (2S,3R)-2-(18F)fluoro-3,6-dimethylheptane |
| SMILES | CC(C)CC[C@@H](C)[C@H](C)[18F] |
| InChI | InChI=1S/C9H19F/c1-7(2)5-6-8(3)9(4)10/h7-9H,5-6H2,1-4H3/t8-,9+/m1/s1/i10-1 |
| InChIKey | MLIWWNZCKOAXAA-LQPBCJROSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |