C7H15F — CID 142291573
(2S,3R)-2-fluoro-3-methylhexane (PubChem CID 142291573) has the molecular formula C7H15F and a molecular weight of 118.20 g/mol. Its IUPAC name is (2S,3R)-2-fluoro-3-methylhexane.
| Compound Name | (2S,3R)-2-fluoro-3-methylhexane |
|---|---|
| PubChem CID | 142291573 |
| Molecular Formula | C7H15F |
| Molecular Weight | 118.20 g/mol |
| Exact Mass | 118.12 |
| IUPAC Name | (2S,3R)-2-fluoro-3-methylhexane |
| SMILES | CCC[C@@H](C)[C@H](C)F |
| InChI | InChI=1S/C7H15F/c1-4-5-6(2)7(3)8/h6-7H,4-5H2,1-3H3/t6-,7+/m1/s1 |
| InChIKey | LJLUYPBDCXAYGW-RQJHMYQMSA-N |
| XLogP | 2.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |