About 1,1-difluorobutane;ethane
1,1-difluorobutane;ethane (PubChem CID 164925096) has the molecular formula C6H14F2
and a molecular weight of 124.17 g/mol. Its IUPAC name is 1,1-difluorobutane;ethane.
Molecular Properties
| Compound Name | 1,1-difluorobutane;ethane |
| PubChem CID | 164925096 |
| Molecular Formula | C6H14F2 |
| Molecular Weight | 124.17 g/mol |
| Exact Mass | 124.11 |
| IUPAC Name | 1,1-difluorobutane;ethane |
| SMILES | CC.CCCC(F)F |
| InChI | InChI=1S/C4H8F2.C2H6/c1-2-3-4(5)6;1-2/h4H,2-3H2,1H3;1-2H3 |
| InChIKey | QZASKASBEULDJN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.17 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1-difluorobutane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluorobutane;ethane?
The IUPAC name of 1,1-difluorobutane;ethane (CID 164925096) is 1,1-difluorobutane;ethane.
What is the SMILES notation for 1,1-difluorobutane;ethane?
The canonical SMILES for 1,1-difluorobutane;ethane is CC.CCCC(F)F.
What is the InChIKey of 1,1-difluorobutane;ethane?
The InChIKey is QZASKASBEULDJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8F2.C2H6/c1-2-3-4(5)6;1-2/h4H,2-3H2,1H3;1-2H3.
What are the key properties of 1,1-difluorobutane;ethane?
1,1-difluorobutane;ethane has a molecular weight of 124.17 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluorobutane;ethane is sourced from PubChem (CID 164925096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).