About 3-fluorohexane;fluoromethane
3-fluorohexane;fluoromethane (PubChem CID 171506304) has the molecular formula C7H16F2
and a molecular weight of 138.20 g/mol. Its IUPAC name is 3-fluorohexane;fluoromethane.
Molecular Properties
| Compound Name | 3-fluorohexane;fluoromethane |
| PubChem CID | 171506304 |
| Molecular Formula | C7H16F2 |
| Molecular Weight | 138.20 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 3-fluorohexane;fluoromethane |
| SMILES | CCCC(F)CC.CF |
| InChI | InChI=1S/C6H13F.CH3F/c1-3-5-6(7)4-2;1-2/h6H,3-5H2,1-2H3;1H3 |
| InChIKey | WVCJKNAWXHKSBD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.20 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-fluorohexane;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluorohexane;fluoromethane?
The IUPAC name of 3-fluorohexane;fluoromethane (CID 171506304) is 3-fluorohexane;fluoromethane.
What is the SMILES notation for 3-fluorohexane;fluoromethane?
The canonical SMILES for 3-fluorohexane;fluoromethane is CCCC(F)CC.CF.
What is the InChIKey of 3-fluorohexane;fluoromethane?
The InChIKey is WVCJKNAWXHKSBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F.CH3F/c1-3-5-6(7)4-2;1-2/h6H,3-5H2,1-2H3;1H3.
What are the key properties of 3-fluorohexane;fluoromethane?
3-fluorohexane;fluoromethane has a molecular weight of 138.20 g/mol, XLogP of 3.12, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluorohexane;fluoromethane is sourced from PubChem (CID 171506304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).