About 1,7-difluorononane
1,7-difluorononane (PubChem CID 168864708) has the molecular formula C9H18F2
and a molecular weight of 164.24 g/mol. Its IUPAC name is 1,7-difluorononane.
Molecular Properties
| Compound Name | 1,7-difluorononane |
| PubChem CID | 168864708 |
| Molecular Formula | C9H18F2 |
| Molecular Weight | 164.24 g/mol |
| Exact Mass | 164.14 |
| IUPAC Name | 1,7-difluorononane |
| SMILES | CCC(F)CCCCCCF |
| InChI | InChI=1S/C9H18F2/c1-2-9(11)7-5-3-4-6-8-10/h9H,2-8H2,1H3 |
| InChIKey | OWDQKNPZMSSTKG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.24 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,7-difluorononane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-difluorononane?
The IUPAC name of 1,7-difluorononane (CID 168864708) is 1,7-difluorononane.
What is the SMILES notation for 1,7-difluorononane?
The canonical SMILES for 1,7-difluorononane is CCC(F)CCCCCCF.
What is the InChIKey of 1,7-difluorononane?
The InChIKey is OWDQKNPZMSSTKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F2/c1-2-9(11)7-5-3-4-6-8-10/h9H,2-8H2,1H3.
What are the key properties of 1,7-difluorononane?
1,7-difluorononane has a molecular weight of 164.24 g/mol, XLogP of 3.65, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-difluorononane is sourced from PubChem (CID 168864708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).