C5H9F3 — CID 87247739
1,2,5-trifluoropentane (PubChem CID 87247739) has the molecular formula C5H9F3 and a molecular weight of 126.12 g/mol. Its IUPAC name is 1,2,5-trifluoropentane.
| Compound Name | 1,2,5-trifluoropentane |
|---|---|
| PubChem CID | 87247739 |
| Molecular Formula | C5H9F3 |
| Molecular Weight | 126.12 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 1,2,5-trifluoropentane |
| SMILES | FCCCC(F)CF |
| InChI | InChI=1S/C5H9F3/c6-3-1-2-5(8)4-7/h5H,1-4H2 |
| InChIKey | XVTHJGGTKFKRBY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.12 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |