About 1,1-dibromo-4-fluorobutane
1,1-dibromo-4-fluorobutane (PubChem CID 54091383) has the molecular formula C4H7Br2F
and a molecular weight of 233.91 g/mol. Its IUPAC name is 1,1-dibromo-4-fluorobutane.
Molecular Properties
| Compound Name | 1,1-dibromo-4-fluorobutane |
| PubChem CID | 54091383 |
| Molecular Formula | C4H7Br2F |
| Molecular Weight | 233.91 g/mol |
| Exact Mass | 231.89 |
| IUPAC Name | 1,1-dibromo-4-fluorobutane |
| SMILES | FCCCC(Br)Br |
| InChI | InChI=1S/C4H7Br2F/c5-4(6)2-1-3-7/h4H,1-3H2 |
| InChIKey | MUCJHLFPORTMNX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.91 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dibromo-4-fluorobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dibromo-4-fluorobutane?
The IUPAC name of 1,1-dibromo-4-fluorobutane (CID 54091383) is 1,1-dibromo-4-fluorobutane.
What is the SMILES notation for 1,1-dibromo-4-fluorobutane?
The canonical SMILES for 1,1-dibromo-4-fluorobutane is FCCCC(Br)Br.
What is the InChIKey of 1,1-dibromo-4-fluorobutane?
The InChIKey is MUCJHLFPORTMNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7Br2F/c5-4(6)2-1-3-7/h4H,1-3H2.
What are the key properties of 1,1-dibromo-4-fluorobutane?
1,1-dibromo-4-fluorobutane has a molecular weight of 233.91 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dibromo-4-fluorobutane is sourced from PubChem (CID 54091383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).