About 8,8-dibromooctan-1-ol
8,8-dibromooctan-1-ol (PubChem CID 87333664) has the molecular formula C8H16Br2O
and a molecular weight of 288.02 g/mol. Its IUPAC name is 8,8-dibromooctan-1-ol.
Molecular Properties
| Compound Name | 8,8-dibromooctan-1-ol |
| PubChem CID | 87333664 |
| Molecular Formula | C8H16Br2O |
| Molecular Weight | 288.02 g/mol |
| Exact Mass | 285.96 |
| IUPAC Name | 8,8-dibromooctan-1-ol |
| SMILES | OCCCCCCCC(Br)Br |
| InChI | InChI=1S/C8H16Br2O/c9-8(10)6-4-2-1-3-5-7-11/h8,11H,1-7H2 |
| InChIKey | JYLWFGFOCPNAOP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.02 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 8,8-dibromooctan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-dibromooctan-1-ol?
The IUPAC name of 8,8-dibromooctan-1-ol (CID 87333664) is 8,8-dibromooctan-1-ol.
What is the SMILES notation for 8,8-dibromooctan-1-ol?
The canonical SMILES for 8,8-dibromooctan-1-ol is OCCCCCCCC(Br)Br.
What is the InChIKey of 8,8-dibromooctan-1-ol?
The InChIKey is JYLWFGFOCPNAOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16Br2O/c9-8(10)6-4-2-1-3-5-7-11/h8,11H,1-7H2.
What are the key properties of 8,8-dibromooctan-1-ol?
8,8-dibromooctan-1-ol has a molecular weight of 288.02 g/mol, XLogP of 3.44, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-dibromooctan-1-ol is sourced from PubChem (CID 87333664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).