C13H25Br3 — CID 118276299
1,1,13-tribromotridecane (PubChem CID 118276299) has the molecular formula C13H25Br3 and a molecular weight of 421.06 g/mol. Its IUPAC name is 1,1,13-tribromotridecane.
| Compound Name | 1,1,13-tribromotridecane |
|---|---|
| PubChem CID | 118276299 |
| Molecular Formula | C13H25Br3 |
| Molecular Weight | 421.06 g/mol |
| Exact Mass | 417.95 |
| IUPAC Name | 1,1,13-tribromotridecane |
| SMILES | BrCCCCCCCCCCCCC(Br)Br |
| InChI | InChI=1S/C13H25Br3/c14-12-10-8-6-4-2-1-3-5-7-9-11-13(15)16/h13H,1-12H2 |
| InChIKey | RWCPOXXWPVYZQD-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.06 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|