C18H34Br4 — CID 54213265
1,8,9,18-tetrabromooctadecane (PubChem CID 54213265) has the molecular formula C18H34Br4 and a molecular weight of 570.09 g/mol. Its IUPAC name is 1,8,9,18-tetrabromooctadecane.
| Compound Name | 1,8,9,18-tetrabromooctadecane |
|---|---|
| PubChem CID | 54213265 |
| Molecular Formula | C18H34Br4 |
| Molecular Weight | 570.09 g/mol |
| Exact Mass | 565.94 |
| IUPAC Name | 1,8,9,18-tetrabromooctadecane |
| SMILES | BrCCCCCCCCCC(Br)C(Br)CCCCCCCBr |
| InChI | InChI=1S/C18H34Br4/c19-15-11-7-3-1-2-5-9-13-17(21)18(22)14-10-6-4-8-12-16-20/h17-18H,1-16H2 |
| InChIKey | PXKDLUNUTHSDPK-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.09 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|