About 1,8-dibromo-1-iodooctane
1,8-dibromo-1-iodooctane (PubChem CID 174451062) has the molecular formula C8H15Br2I
and a molecular weight of 397.92 g/mol. Its IUPAC name is 1,8-dibromo-1-iodooctane.
Molecular Properties
| Compound Name | 1,8-dibromo-1-iodooctane |
| PubChem CID | 174451062 |
| Molecular Formula | C8H15Br2I |
| Molecular Weight | 397.92 g/mol |
| Exact Mass | 395.86 |
| IUPAC Name | 1,8-dibromo-1-iodooctane |
| SMILES | BrCCCCCCCC(Br)I |
| InChI | InChI=1S/C8H15Br2I/c9-7-5-3-1-2-4-6-8(10)11/h8H,1-7H2 |
| InChIKey | VKYSEJWCVQQPEJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.92 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,8-dibromo-1-iodooctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-dibromo-1-iodooctane?
The IUPAC name of 1,8-dibromo-1-iodooctane (CID 174451062) is 1,8-dibromo-1-iodooctane.
What is the SMILES notation for 1,8-dibromo-1-iodooctane?
The canonical SMILES for 1,8-dibromo-1-iodooctane is BrCCCCCCCC(Br)I.
What is the InChIKey of 1,8-dibromo-1-iodooctane?
The InChIKey is VKYSEJWCVQQPEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15Br2I/c9-7-5-3-1-2-4-6-8(10)11/h8H,1-7H2.
What are the key properties of 1,8-dibromo-1-iodooctane?
1,8-dibromo-1-iodooctane has a molecular weight of 397.92 g/mol, XLogP of 4.88, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-dibromo-1-iodooctane is sourced from PubChem (CID 174451062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).