C7H13Br3 — CID 140914987
1,2,7-tribromoheptane (PubChem CID 140914987) has the molecular formula C7H13Br3 and a molecular weight of 336.89 g/mol. Its IUPAC name is 1,2,7-tribromoheptane.
| Compound Name | 1,2,7-tribromoheptane |
|---|---|
| PubChem CID | 140914987 |
| Molecular Formula | C7H13Br3 |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 333.86 |
| IUPAC Name | 1,2,7-tribromoheptane |
| SMILES | BrCCCCCC(Br)CBr |
| InChI | InChI=1S/C7H13Br3/c8-5-3-1-2-4-7(10)6-9/h7H,1-6H2 |
| InChIKey | GUFNWEFNENKHKU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|