C12H22Br4O — CID 154634435
1,6-dibromo-1-(1,6-dibromohexoxy)hexane (PubChem CID 154634435) has the molecular formula C12H22Br4O and a molecular weight of 501.92 g/mol. Its IUPAC name is 1,6-dibromo-1-(1,6-dibromohexoxy)hexane.
| Compound Name | 1,6-dibromo-1-(1,6-dibromohexoxy)hexane |
|---|---|
| PubChem CID | 154634435 |
| Molecular Formula | C12H22Br4O |
| Molecular Weight | 501.92 g/mol |
| Exact Mass | 497.84 |
| IUPAC Name | 1,6-dibromo-1-(1,6-dibromohexoxy)hexane |
| SMILES | BrCCCCCC(Br)OC(Br)CCCCCBr |
| InChI | InChI=1S/C12H22Br4O/c13-9-5-1-3-7-11(15)17-12(16)8-4-2-6-10-14/h11-12H,1-10H2 |
| InChIKey | SMTHLLGFZRBBKY-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.92 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|