C12H20Br6O — CID 175064972
1,2,3,4,5,12-hexabromododecan-1-ol (PubChem CID 175064972) has the molecular formula C12H20Br6O and a molecular weight of 659.71 g/mol. Its IUPAC name is 1,2,3,4,5,12-hexabromododecan-1-ol.
| Compound Name | 1,2,3,4,5,12-hexabromododecan-1-ol |
|---|---|
| PubChem CID | 175064972 |
| Molecular Formula | C12H20Br6O |
| Molecular Weight | 659.71 g/mol |
| Exact Mass | 653.66 |
| IUPAC Name | 1,2,3,4,5,12-hexabromododecan-1-ol |
| SMILES | OC(Br)C(Br)C(Br)C(Br)C(Br)CCCCCCCBr |
| InChI | InChI=1S/C12H20Br6O/c13-7-5-3-1-2-4-6-8(14)9(15)10(16)11(17)12(18)19/h8-12,19H,1-7H2 |
| InChIKey | ZIDXNWLIYKUEPP-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.71 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|