About 12-bromododecan-3-ol
12-bromododecan-3-ol (PubChem CID 10706786) has the molecular formula C12H25BrO
and a molecular weight of 265.23 g/mol. Its IUPAC name is 12-bromododecan-3-ol.
Molecular Properties
| Compound Name | 12-bromododecan-3-ol |
| PubChem CID | 10706786 |
| Molecular Formula | C12H25BrO |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 12-bromododecan-3-ol |
| SMILES | CCC(O)CCCCCCCCCBr |
| InChI | InChI=1S/C12H25BrO/c1-2-12(14)10-8-6-4-3-5-7-9-11-13/h12,14H,2-11H2,1H3 |
| InChIKey | QMRIZCCTRUEVGR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 12-bromododecan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-bromododecan-3-ol?
The IUPAC name of 12-bromododecan-3-ol (CID 10706786) is 12-bromododecan-3-ol.
What is the SMILES notation for 12-bromododecan-3-ol?
The canonical SMILES for 12-bromododecan-3-ol is CCC(O)CCCCCCCCCBr.
What is the InChIKey of 12-bromododecan-3-ol?
The InChIKey is QMRIZCCTRUEVGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25BrO/c1-2-12(14)10-8-6-4-3-5-7-9-11-13/h12,14H,2-11H2,1H3.
What are the key properties of 12-bromododecan-3-ol?
12-bromododecan-3-ol has a molecular weight of 265.23 g/mol, XLogP of 4.27, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 12-bromododecan-3-ol is sourced from PubChem (CID 10706786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).