About 5,5-dibromopentylphosphane
5,5-dibromopentylphosphane (PubChem CID 23341376) has the molecular formula C5H11Br2P
and a molecular weight of 261.92 g/mol. Its IUPAC name is 5,5-dibromopentylphosphane.
Molecular Properties
| Compound Name | 5,5-dibromopentylphosphane |
| PubChem CID | 23341376 |
| Molecular Formula | C5H11Br2P |
| Molecular Weight | 261.92 g/mol |
| Exact Mass | 259.90 |
| IUPAC Name | 5,5-dibromopentylphosphane |
| SMILES | PCCCCC(Br)Br |
| InChI | InChI=1S/C5H11Br2P/c6-5(7)3-1-2-4-8/h5H,1-4,8H2 |
| InChIKey | AIFLVSCWMYNJFB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.92 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dibromopentylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dibromopentylphosphane?
The IUPAC name of 5,5-dibromopentylphosphane (CID 23341376) is 5,5-dibromopentylphosphane.
What is the SMILES notation for 5,5-dibromopentylphosphane?
The canonical SMILES for 5,5-dibromopentylphosphane is PCCCCC(Br)Br.
What is the InChIKey of 5,5-dibromopentylphosphane?
The InChIKey is AIFLVSCWMYNJFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11Br2P/c6-5(7)3-1-2-4-8/h5H,1-4,8H2.
What are the key properties of 5,5-dibromopentylphosphane?
5,5-dibromopentylphosphane has a molecular weight of 261.92 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dibromopentylphosphane is sourced from PubChem (CID 23341376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).