About 5-ethylheptylphosphane
5-ethylheptylphosphane (PubChem CID 90926602) has the molecular formula C9H21P
and a molecular weight of 160.24 g/mol. Its IUPAC name is 5-ethylheptylphosphane.
Molecular Properties
| Compound Name | 5-ethylheptylphosphane |
| PubChem CID | 90926602 |
| Molecular Formula | C9H21P |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.14 |
| IUPAC Name | 5-ethylheptylphosphane |
| SMILES | CCC(CC)CCCCP |
| InChI | InChI=1S/C9H21P/c1-3-9(4-2)7-5-6-8-10/h9H,3-8,10H2,1-2H3 |
| InChIKey | UOKAJCOJEPGLPB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-ethylheptylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylheptylphosphane?
The IUPAC name of 5-ethylheptylphosphane (CID 90926602) is 5-ethylheptylphosphane.
What is the SMILES notation for 5-ethylheptylphosphane?
The canonical SMILES for 5-ethylheptylphosphane is CCC(CC)CCCCP.
What is the InChIKey of 5-ethylheptylphosphane?
The InChIKey is UOKAJCOJEPGLPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21P/c1-3-9(4-2)7-5-6-8-10/h9H,3-8,10H2,1-2H3.
What are the key properties of 5-ethylheptylphosphane?
5-ethylheptylphosphane has a molecular weight of 160.24 g/mol, XLogP of 3.47, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylheptylphosphane is sourced from PubChem (CID 90926602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).