About 3,6-diethyloctane
3,6-diethyloctane (PubChem CID 526424) has the molecular formula C12H26
and a molecular weight of 170.34 g/mol. Its IUPAC name is 3,6-diethyloctane.
Molecular Properties
| Compound Name | 3,6-diethyloctane |
| PubChem CID | 526424 |
| Molecular Formula | C12H26 |
| Molecular Weight | 170.34 g/mol |
| Exact Mass | 170.20 |
| IUPAC Name | 3,6-diethyloctane |
| SMILES | CCC(CC)CCC(CC)CC |
| InChI | InChI=1S/C12H26/c1-5-11(6-2)9-10-12(7-3)8-4/h11-12H,5-10H2,1-4H3 |
| InChIKey | UTCTYSTYZOAAOS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3,6-diethyloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diethyloctane?
The IUPAC name of 3,6-diethyloctane (CID 526424) is 3,6-diethyloctane.
What is the SMILES notation for 3,6-diethyloctane?
The canonical SMILES for 3,6-diethyloctane is CCC(CC)CCC(CC)CC.
What is the InChIKey of 3,6-diethyloctane?
The InChIKey is UTCTYSTYZOAAOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26/c1-5-11(6-2)9-10-12(7-3)8-4/h11-12H,5-10H2,1-4H3.
What are the key properties of 3,6-diethyloctane?
3,6-diethyloctane has a molecular weight of 170.34 g/mol, XLogP of 4.64, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diethyloctane is sourced from PubChem (CID 526424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).