About 4-ethylheptane;methane
4-ethylheptane;methane (PubChem CID 143165373) has the molecular formula C11H28
and a molecular weight of 160.34 g/mol. Its IUPAC name is 4-ethylheptane;methane.
Molecular Properties
| Compound Name | 4-ethylheptane;methane |
| PubChem CID | 143165373 |
| Molecular Formula | C11H28 |
| Molecular Weight | 160.34 g/mol |
| Exact Mass | 160.22 |
| IUPAC Name | 4-ethylheptane;methane |
| SMILES | C.C.CCCC(CC)CCC |
| InChI | InChI=1S/C9H20.2CH4/c1-4-7-9(6-3)8-5-2;;/h9H,4-8H2,1-3H3;2*1H4 |
| InChIKey | VKVFUQDZHFWCMX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-ethylheptane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylheptane;methane?
The IUPAC name of 4-ethylheptane;methane (CID 143165373) is 4-ethylheptane;methane.
What is the SMILES notation for 4-ethylheptane;methane?
The canonical SMILES for 4-ethylheptane;methane is C.C.CCCC(CC)CCC.
What is the InChIKey of 4-ethylheptane;methane?
The InChIKey is VKVFUQDZHFWCMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20.2CH4/c1-4-7-9(6-3)8-5-2;;/h9H,4-8H2,1-3H3;2*1H4.
What are the key properties of 4-ethylheptane;methane?
4-ethylheptane;methane has a molecular weight of 160.34 g/mol, XLogP of 4.89, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylheptane;methane is sourced from PubChem (CID 143165373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).