About 4-ethyl-1-fluoroheptane
4-ethyl-1-fluoroheptane (PubChem CID 174734694) has the molecular formula C9H19F
and a molecular weight of 146.25 g/mol. Its IUPAC name is 4-ethyl-1-fluoroheptane.
Molecular Properties
| Compound Name | 4-ethyl-1-fluoroheptane |
| PubChem CID | 174734694 |
| Molecular Formula | C9H19F |
| Molecular Weight | 146.25 g/mol |
| Exact Mass | 146.15 |
| IUPAC Name | 4-ethyl-1-fluoroheptane |
| SMILES | CCCC(CC)CCCF |
| InChI | InChI=1S/C9H19F/c1-3-6-9(4-2)7-5-8-10/h9H,3-8H2,1-2H3 |
| InChIKey | XLLQBAWFYTZUPZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-ethyl-1-fluoroheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1-fluoroheptane?
The IUPAC name of 4-ethyl-1-fluoroheptane (CID 174734694) is 4-ethyl-1-fluoroheptane.
What is the SMILES notation for 4-ethyl-1-fluoroheptane?
The canonical SMILES for 4-ethyl-1-fluoroheptane is CCCC(CC)CCCF.
What is the InChIKey of 4-ethyl-1-fluoroheptane?
The InChIKey is XLLQBAWFYTZUPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F/c1-3-6-9(4-2)7-5-8-10/h9H,3-8H2,1-2H3.
What are the key properties of 4-ethyl-1-fluoroheptane?
4-ethyl-1-fluoroheptane has a molecular weight of 146.25 g/mol, XLogP of 3.56, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1-fluoroheptane is sourced from PubChem (CID 174734694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).