About dodecylphosphane;2-ethyldodecylphosphane
dodecylphosphane;2-ethyldodecylphosphane (PubChem CID 122690433) has the molecular formula C26H58P2
and a molecular weight of 432.70 g/mol. Its IUPAC name is dodecylphosphane;2-ethyldodecylphosphane.
Molecular Properties
| Compound Name | dodecylphosphane;2-ethyldodecylphosphane |
| PubChem CID | 122690433 |
| Molecular Formula | C26H58P2 |
| Molecular Weight | 432.70 g/mol |
| Exact Mass | 432.40 |
| IUPAC Name | dodecylphosphane;2-ethyldodecylphosphane |
| SMILES | CCCCCCCCCCC(CC)CP.CCCCCCCCCCCCP |
| InChI | InChI=1S/C14H31P.C12H27P/c1-3-5-6-7-8-9-10-11-12-14(4-2)13-15;1-2-3-4-5-6-7-8-9-10-11-12-13/h14H,3-13,15H2,1-2H3;2-13H2,1H3 |
| InChIKey | NLAWGGTXNXZGIR-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.70 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dodecylphosphane;2-ethyldodecylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecylphosphane;2-ethyldodecylphosphane?
The IUPAC name of dodecylphosphane;2-ethyldodecylphosphane (CID 122690433) is dodecylphosphane;2-ethyldodecylphosphane.
What is the SMILES notation for dodecylphosphane;2-ethyldodecylphosphane?
The canonical SMILES for dodecylphosphane;2-ethyldodecylphosphane is CCCCCCCCCCC(CC)CP.CCCCCCCCCCCCP.
What is the InChIKey of dodecylphosphane;2-ethyldodecylphosphane?
The InChIKey is NLAWGGTXNXZGIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31P.C12H27P/c1-3-5-6-7-8-9-10-11-12-14(4-2)13-15;1-2-3-4-5-6-7-8-9-10-11-12-13/h14H,3-13,15H2,1-2H3;2-13H2,1H3.
What are the key properties of dodecylphosphane;2-ethyldodecylphosphane?
dodecylphosphane;2-ethyldodecylphosphane has a molecular weight of 432.70 g/mol, XLogP of 10.20, 21 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dodecylphosphane;2-ethyldodecylphosphane is sourced from PubChem (CID 122690433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).