About 5-ethylheptane-1-thiol
5-ethylheptane-1-thiol (PubChem CID 141457634) has the molecular formula C9H20S
and a molecular weight of 160.33 g/mol. Its IUPAC name is 5-ethylheptane-1-thiol.
Molecular Properties
| Compound Name | 5-ethylheptane-1-thiol |
| PubChem CID | 141457634 |
| Molecular Formula | C9H20S |
| Molecular Weight | 160.33 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 5-ethylheptane-1-thiol |
| SMILES | CCC(CC)CCCCS |
| InChI | InChI=1S/C9H20S/c1-3-9(4-2)7-5-6-8-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | OUUBKGSHEDJDKO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-ethylheptane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylheptane-1-thiol?
The IUPAC name of 5-ethylheptane-1-thiol (CID 141457634) is 5-ethylheptane-1-thiol.
What is the SMILES notation for 5-ethylheptane-1-thiol?
The canonical SMILES for 5-ethylheptane-1-thiol is CCC(CC)CCCCS.
What is the InChIKey of 5-ethylheptane-1-thiol?
The InChIKey is OUUBKGSHEDJDKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20S/c1-3-9(4-2)7-5-6-8-10/h9-10H,3-8H2,1-2H3.
What are the key properties of 5-ethylheptane-1-thiol?
5-ethylheptane-1-thiol has a molecular weight of 160.33 g/mol, XLogP of 3.52, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylheptane-1-thiol is sourced from PubChem (CID 141457634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).