About 2-ethyloctane-1,8-dithiol
2-ethyloctane-1,8-dithiol (PubChem CID 122629942) has the molecular formula C10H22S2
and a molecular weight of 206.42 g/mol. Its IUPAC name is 2-ethyloctane-1,8-dithiol.
Molecular Properties
| Compound Name | 2-ethyloctane-1,8-dithiol |
| PubChem CID | 122629942 |
| Molecular Formula | C10H22S2 |
| Molecular Weight | 206.42 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-ethyloctane-1,8-dithiol |
| SMILES | CCC(CS)CCCCCCS |
| InChI | InChI=1S/C10H22S2/c1-2-10(9-12)7-5-3-4-6-8-11/h10-12H,2-9H2,1H3 |
| InChIKey | WEBTZCTWUBVWIJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyloctane-1,8-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyloctane-1,8-dithiol?
The IUPAC name of 2-ethyloctane-1,8-dithiol (CID 122629942) is 2-ethyloctane-1,8-dithiol.
What is the SMILES notation for 2-ethyloctane-1,8-dithiol?
The canonical SMILES for 2-ethyloctane-1,8-dithiol is CCC(CS)CCCCCCS.
What is the InChIKey of 2-ethyloctane-1,8-dithiol?
The InChIKey is WEBTZCTWUBVWIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22S2/c1-2-10(9-12)7-5-3-4-6-8-11/h10-12H,2-9H2,1H3.
What are the key properties of 2-ethyloctane-1,8-dithiol?
2-ethyloctane-1,8-dithiol has a molecular weight of 206.42 g/mol, XLogP of 3.82, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyloctane-1,8-dithiol is sourced from PubChem (CID 122629942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).