About 2-ethylhexane-1-thiol;molybdenum
2-ethylhexane-1-thiol;molybdenum (PubChem CID 88652691) has the molecular formula C8H18MoS
and a molecular weight of 242.24 g/mol. Its IUPAC name is 2-ethylhexane-1-thiol;molybdenum.
Molecular Properties
| Compound Name | 2-ethylhexane-1-thiol;molybdenum |
| PubChem CID | 88652691 |
| Molecular Formula | C8H18MoS |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 2-ethylhexane-1-thiol;molybdenum |
| SMILES | CCCCC(CC)CS.[Mo] |
| InChI | InChI=1S/C8H18S.Mo/c1-3-5-6-8(4-2)7-9;/h8-9H,3-7H2,1-2H3; |
| InChIKey | WSVBKDOXZNUCDY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexane-1-thiol;molybdenum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexane-1-thiol;molybdenum?
The IUPAC name of 2-ethylhexane-1-thiol;molybdenum (CID 88652691) is 2-ethylhexane-1-thiol;molybdenum.
What is the SMILES notation for 2-ethylhexane-1-thiol;molybdenum?
The canonical SMILES for 2-ethylhexane-1-thiol;molybdenum is CCCCC(CC)CS.[Mo].
What is the InChIKey of 2-ethylhexane-1-thiol;molybdenum?
The InChIKey is WSVBKDOXZNUCDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18S.Mo/c1-3-5-6-8(4-2)7-9;/h8-9H,3-7H2,1-2H3;.
What are the key properties of 2-ethylhexane-1-thiol;molybdenum?
2-ethylhexane-1-thiol;molybdenum has a molecular weight of 242.24 g/mol, XLogP of 3.13, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexane-1-thiol;molybdenum is sourced from PubChem (CID 88652691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).