About 2-octyl-6-propylnonane-1,9-dithiol
2-octyl-6-propylnonane-1,9-dithiol (PubChem CID 175780572) has the molecular formula C20H42S2
and a molecular weight of 346.69 g/mol. Its IUPAC name is 2-octyl-6-propylnonane-1,9-dithiol.
Molecular Properties
| Compound Name | 2-octyl-6-propylnonane-1,9-dithiol |
| PubChem CID | 175780572 |
| Molecular Formula | C20H42S2 |
| Molecular Weight | 346.69 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | 2-octyl-6-propylnonane-1,9-dithiol |
| SMILES | CCCCCCCCC(CS)CCCC(CCC)CCCS |
| InChI | InChI=1S/C20H42S2/c1-3-5-6-7-8-9-13-20(18-22)15-10-14-19(12-4-2)16-11-17-21/h19-22H,3-18H2,1-2H3 |
| InChIKey | ACYSXZTYDHIIMG-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.69 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-octyl-6-propylnonane-1,9-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octyl-6-propylnonane-1,9-dithiol?
The IUPAC name of 2-octyl-6-propylnonane-1,9-dithiol (CID 175780572) is 2-octyl-6-propylnonane-1,9-dithiol.
What is the SMILES notation for 2-octyl-6-propylnonane-1,9-dithiol?
The canonical SMILES for 2-octyl-6-propylnonane-1,9-dithiol is CCCCCCCCC(CS)CCCC(CCC)CCCS.
What is the InChIKey of 2-octyl-6-propylnonane-1,9-dithiol?
The InChIKey is ACYSXZTYDHIIMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42S2/c1-3-5-6-7-8-9-13-20(18-22)15-10-14-19(12-4-2)16-11-17-21/h19-22H,3-18H2,1-2H3.
What are the key properties of 2-octyl-6-propylnonane-1,9-dithiol?
2-octyl-6-propylnonane-1,9-dithiol has a molecular weight of 346.69 g/mol, XLogP of 7.58, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octyl-6-propylnonane-1,9-dithiol is sourced from PubChem (CID 175780572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).