About 3-nonylhexane-1,6-dithiol
3-nonylhexane-1,6-dithiol (PubChem CID 88810503) has the molecular formula C15H32S2
and a molecular weight of 276.55 g/mol. Its IUPAC name is 3-nonylhexane-1,6-dithiol.
Molecular Properties
| Compound Name | 3-nonylhexane-1,6-dithiol |
| PubChem CID | 88810503 |
| Molecular Formula | C15H32S2 |
| Molecular Weight | 276.55 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 3-nonylhexane-1,6-dithiol |
| SMILES | CCCCCCCCCC(CCS)CCCS |
| InChI | InChI=1S/C15H32S2/c1-2-3-4-5-6-7-8-10-15(12-14-17)11-9-13-16/h15-17H,2-14H2,1H3 |
| InChIKey | WSEILAZYCCBAQE-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-nonylhexane-1,6-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nonylhexane-1,6-dithiol?
The IUPAC name of 3-nonylhexane-1,6-dithiol (CID 88810503) is 3-nonylhexane-1,6-dithiol.
What is the SMILES notation for 3-nonylhexane-1,6-dithiol?
The canonical SMILES for 3-nonylhexane-1,6-dithiol is CCCCCCCCCC(CCS)CCCS.
What is the InChIKey of 3-nonylhexane-1,6-dithiol?
The InChIKey is WSEILAZYCCBAQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32S2/c1-2-3-4-5-6-7-8-10-15(12-14-17)11-9-13-16/h15-17H,2-14H2,1H3.
What are the key properties of 3-nonylhexane-1,6-dithiol?
3-nonylhexane-1,6-dithiol has a molecular weight of 276.55 g/mol, XLogP of 5.77, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nonylhexane-1,6-dithiol is sourced from PubChem (CID 88810503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).