About 2,13-dibromotetradecane
2,13-dibromotetradecane (PubChem CID 150586187) has the molecular formula C14H28Br2
and a molecular weight of 356.19 g/mol. Its IUPAC name is 2,13-dibromotetradecane.
Molecular Properties
| Compound Name | 2,13-dibromotetradecane |
| PubChem CID | 150586187 |
| Molecular Formula | C14H28Br2 |
| Molecular Weight | 356.19 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 2,13-dibromotetradecane |
| SMILES | CC(Br)CCCCCCCCCCC(C)Br |
| InChI | InChI=1S/C14H28Br2/c1-13(15)11-9-7-5-3-4-6-8-10-12-14(2)16/h13-14H,3-12H2,1-2H3 |
| InChIKey | IOWXPACCEDZPAV-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.19 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,13-dibromotetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,13-dibromotetradecane?
The IUPAC name of 2,13-dibromotetradecane (CID 150586187) is 2,13-dibromotetradecane.
What is the SMILES notation for 2,13-dibromotetradecane?
The canonical SMILES for 2,13-dibromotetradecane is CC(Br)CCCCCCCCCCC(C)Br.
What is the InChIKey of 2,13-dibromotetradecane?
The InChIKey is IOWXPACCEDZPAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28Br2/c1-13(15)11-9-7-5-3-4-6-8-10-12-14(2)16/h13-14H,3-12H2,1-2H3.
What are the key properties of 2,13-dibromotetradecane?
2,13-dibromotetradecane has a molecular weight of 356.19 g/mol, XLogP of 6.45, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,13-dibromotetradecane is sourced from PubChem (CID 150586187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).