About 15-bromohexadecanoic acid
15-bromohexadecanoic acid (PubChem CID 22242436) has the molecular formula C16H31BrO2
and a molecular weight of 335.33 g/mol. Its IUPAC name is 15-bromohexadecanoic acid.
Molecular Properties
| Compound Name | 15-bromohexadecanoic acid |
| PubChem CID | 22242436 |
| Molecular Formula | C16H31BrO2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 15-bromohexadecanoic acid |
| SMILES | CC(Br)CCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C16H31BrO2/c1-15(17)13-11-9-7-5-3-2-4-6-8-10-12-14-16(18)19/h15H,2-14H2,1H3,(H,18,19) |
| InChIKey | KXXXYAUDWHLQAR-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 15-bromohexadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 15-bromohexadecanoic acid?
The IUPAC name of 15-bromohexadecanoic acid (CID 22242436) is 15-bromohexadecanoic acid.
What is the SMILES notation for 15-bromohexadecanoic acid?
The canonical SMILES for 15-bromohexadecanoic acid is CC(Br)CCCCCCCCCCCCCC(=O)O.
What is the InChIKey of 15-bromohexadecanoic acid?
The InChIKey is KXXXYAUDWHLQAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31BrO2/c1-15(17)13-11-9-7-5-3-2-4-6-8-10-12-14-16(18)19/h15H,2-14H2,1H3,(H,18,19).
What are the key properties of 15-bromohexadecanoic acid?
15-bromohexadecanoic acid has a molecular weight of 335.33 g/mol, XLogP of 5.93, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 15-bromohexadecanoic acid is sourced from PubChem (CID 22242436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).