About 2-bromotridecane;morpholine
2-bromotridecane;morpholine (PubChem CID 70520110) has the molecular formula C17H36BrNO
and a molecular weight of 350.39 g/mol. Its IUPAC name is 2-bromotridecane;morpholine.
Molecular Properties
| Compound Name | 2-bromotridecane;morpholine |
| PubChem CID | 70520110 |
| Molecular Formula | C17H36BrNO |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 2-bromotridecane;morpholine |
| SMILES | C1COCCN1.CCCCCCCCCCCC(C)Br |
| InChI | InChI=1S/C13H27Br.C4H9NO/c1-3-4-5-6-7-8-9-10-11-12-13(2)14;1-3-6-4-2-5-1/h13H,3-12H2,1-2H3;5H,1-4H2 |
| InChIKey | KZTALALVEGIYSW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromotridecane;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromotridecane;morpholine?
The IUPAC name of 2-bromotridecane;morpholine (CID 70520110) is 2-bromotridecane;morpholine.
What is the SMILES notation for 2-bromotridecane;morpholine?
The canonical SMILES for 2-bromotridecane;morpholine is C1COCCN1.CCCCCCCCCCCC(C)Br.
What is the InChIKey of 2-bromotridecane;morpholine?
The InChIKey is KZTALALVEGIYSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27Br.C4H9NO/c1-3-4-5-6-7-8-9-10-11-12-13(2)14;1-3-6-4-2-5-1/h13H,3-12H2,1-2H3;5H,1-4H2.
What are the key properties of 2-bromotridecane;morpholine?
2-bromotridecane;morpholine has a molecular weight of 350.39 g/mol, XLogP of 5.30, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromotridecane;morpholine is sourced from PubChem (CID 70520110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).