About 3-bromo-2-methyldodecane
3-bromo-2-methyldodecane (PubChem CID 63470480) has the molecular formula C13H27Br
and a molecular weight of 263.26 g/mol. Its IUPAC name is 3-bromo-2-methyldodecane.
Molecular Properties
| Compound Name | 3-bromo-2-methyldodecane |
| PubChem CID | 63470480 |
| Molecular Formula | C13H27Br |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-bromo-2-methyldodecane |
| SMILES | CCCCCCCCCC(Br)C(C)C |
| InChI | InChI=1S/C13H27Br/c1-4-5-6-7-8-9-10-11-13(14)12(2)3/h12-13H,4-11H2,1-3H3 |
| InChIKey | TVFMWYYZKKBGKJ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-methyldodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-methyldodecane?
The IUPAC name of 3-bromo-2-methyldodecane (CID 63470480) is 3-bromo-2-methyldodecane.
What is the SMILES notation for 3-bromo-2-methyldodecane?
The canonical SMILES for 3-bromo-2-methyldodecane is CCCCCCCCCC(Br)C(C)C.
What is the InChIKey of 3-bromo-2-methyldodecane?
The InChIKey is TVFMWYYZKKBGKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27Br/c1-4-5-6-7-8-9-10-11-13(14)12(2)3/h12-13H,4-11H2,1-3H3.
What are the key properties of 3-bromo-2-methyldodecane?
3-bromo-2-methyldodecane has a molecular weight of 263.26 g/mol, XLogP of 5.55, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-methyldodecane is sourced from PubChem (CID 63470480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).