About 2-bromo-3-methylundecane
2-bromo-3-methylundecane (PubChem CID 63470862) has the molecular formula C12H25Br
and a molecular weight of 249.24 g/mol. Its IUPAC name is 2-bromo-3-methylundecane.
Molecular Properties
| Compound Name | 2-bromo-3-methylundecane |
| PubChem CID | 63470862 |
| Molecular Formula | C12H25Br |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-bromo-3-methylundecane |
| SMILES | CCCCCCCCC(C)C(C)Br |
| InChI | InChI=1S/C12H25Br/c1-4-5-6-7-8-9-10-11(2)12(3)13/h11-12H,4-10H2,1-3H3 |
| InChIKey | PDDANTMNBATYOU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3-methylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3-methylundecane?
The IUPAC name of 2-bromo-3-methylundecane (CID 63470862) is 2-bromo-3-methylundecane.
What is the SMILES notation for 2-bromo-3-methylundecane?
The canonical SMILES for 2-bromo-3-methylundecane is CCCCCCCCC(C)C(C)Br.
What is the InChIKey of 2-bromo-3-methylundecane?
The InChIKey is PDDANTMNBATYOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25Br/c1-4-5-6-7-8-9-10-11(2)12(3)13/h11-12H,4-10H2,1-3H3.
What are the key properties of 2-bromo-3-methylundecane?
2-bromo-3-methylundecane has a molecular weight of 249.24 g/mol, XLogP of 5.16, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-methylundecane is sourced from PubChem (CID 63470862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).