About 3-bromo-2-methyldecane
3-bromo-2-methyldecane (PubChem CID 63470479) has the molecular formula C11H23Br
and a molecular weight of 235.21 g/mol. Its IUPAC name is 3-bromo-2-methyldecane.
Molecular Properties
| Compound Name | 3-bromo-2-methyldecane |
| PubChem CID | 63470479 |
| Molecular Formula | C11H23Br |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 3-bromo-2-methyldecane |
| SMILES | CCCCCCCC(Br)C(C)C |
| InChI | InChI=1S/C11H23Br/c1-4-5-6-7-8-9-11(12)10(2)3/h10-11H,4-9H2,1-3H3 |
| InChIKey | DNALXHRONYXYBL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-methyldecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-methyldecane?
The IUPAC name of 3-bromo-2-methyldecane (CID 63470479) is 3-bromo-2-methyldecane.
What is the SMILES notation for 3-bromo-2-methyldecane?
The canonical SMILES for 3-bromo-2-methyldecane is CCCCCCCC(Br)C(C)C.
What is the InChIKey of 3-bromo-2-methyldecane?
The InChIKey is DNALXHRONYXYBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23Br/c1-4-5-6-7-8-9-11(12)10(2)3/h10-11H,4-9H2,1-3H3.
What are the key properties of 3-bromo-2-methyldecane?
3-bromo-2-methyldecane has a molecular weight of 235.21 g/mol, XLogP of 4.77, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-methyldecane is sourced from PubChem (CID 63470479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).