About morpholine;tetrabutylazanium
morpholine;tetrabutylazanium (PubChem CID 174955494) has the molecular formula C20H45N2O+
and a molecular weight of 329.59 g/mol. Its IUPAC name is morpholine;tetrabutylazanium.
Molecular Properties
| Compound Name | morpholine;tetrabutylazanium |
| PubChem CID | 174955494 |
| Molecular Formula | C20H45N2O+ |
| Molecular Weight | 329.59 g/mol |
| Exact Mass | 329.35 |
| IUPAC Name | morpholine;tetrabutylazanium |
| SMILES | C1COCCN1.CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36N.C4H9NO/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-3-6-4-2-5-1/h5-16H2,1-4H3;5H,1-4H2/q+1; |
| InChIKey | FXBPKMDVNNMLQT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze morpholine;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine;tetrabutylazanium?
The IUPAC name of morpholine;tetrabutylazanium (CID 174955494) is morpholine;tetrabutylazanium.
What is the SMILES notation for morpholine;tetrabutylazanium?
The canonical SMILES for morpholine;tetrabutylazanium is C1COCCN1.CCCC[N+](CCCC)(CCCC)CCCC.
What is the InChIKey of morpholine;tetrabutylazanium?
The InChIKey is FXBPKMDVNNMLQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.C4H9NO/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-3-6-4-2-5-1/h5-16H2,1-4H3;5H,1-4H2/q+1;.
What are the key properties of morpholine;tetrabutylazanium?
morpholine;tetrabutylazanium has a molecular weight of 329.59 g/mol, XLogP of 4.61, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine;tetrabutylazanium is sourced from PubChem (CID 174955494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).