About oxolane;tetrabutylazanium
oxolane;tetrabutylazanium (PubChem CID 159740735) has the molecular formula C24H52NO2+
and a molecular weight of 386.69 g/mol. Its IUPAC name is oxolane;tetrabutylazanium.
Molecular Properties
| Compound Name | oxolane;tetrabutylazanium |
| PubChem CID | 159740735 |
| Molecular Formula | C24H52NO2+ |
| Molecular Weight | 386.69 g/mol |
| Exact Mass | 386.40 |
| IUPAC Name | oxolane;tetrabutylazanium |
| SMILES | C1CCOC1.C1CCOC1.CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36N.2C4H8O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2*1-2-4-5-3-1/h5-16H2,1-4H3;2*1-4H2/q+1;; |
| InChIKey | NCKPTESMUGGRRQ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.69 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze oxolane;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolane;tetrabutylazanium?
The IUPAC name of oxolane;tetrabutylazanium (CID 159740735) is oxolane;tetrabutylazanium.
What is the SMILES notation for oxolane;tetrabutylazanium?
The canonical SMILES for oxolane;tetrabutylazanium is C1CCOC1.C1CCOC1.CCCC[N+](CCCC)(CCCC)CCCC.
What is the InChIKey of oxolane;tetrabutylazanium?
The InChIKey is NCKPTESMUGGRRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.2C4H8O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2*1-2-4-5-3-1/h5-16H2,1-4H3;2*1-4H2/q+1;;.
What are the key properties of oxolane;tetrabutylazanium?
oxolane;tetrabutylazanium has a molecular weight of 386.69 g/mol, XLogP of 6.60, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxolane;tetrabutylazanium is sourced from PubChem (CID 159740735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).