About 2,5-difluoro-1-iodopentane
2,5-difluoro-1-iodopentane (PubChem CID 175232085) has the molecular formula C5H9F2I
and a molecular weight of 234.03 g/mol. Its IUPAC name is 2,5-difluoro-1-iodopentane.
Molecular Properties
| Compound Name | 2,5-difluoro-1-iodopentane |
| PubChem CID | 175232085 |
| Molecular Formula | C5H9F2I |
| Molecular Weight | 234.03 g/mol |
| Exact Mass | 233.97 |
| IUPAC Name | 2,5-difluoro-1-iodopentane |
| SMILES | FCCCC(F)CI |
| InChI | InChI=1S/C5H9F2I/c6-3-1-2-5(7)4-8/h5H,1-4H2 |
| InChIKey | PUFBXJPEBHVXHZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.03 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,5-difluoro-1-iodopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-difluoro-1-iodopentane?
The IUPAC name of 2,5-difluoro-1-iodopentane (CID 175232085) is 2,5-difluoro-1-iodopentane.
What is the SMILES notation for 2,5-difluoro-1-iodopentane?
The canonical SMILES for 2,5-difluoro-1-iodopentane is FCCCC(F)CI.
What is the InChIKey of 2,5-difluoro-1-iodopentane?
The InChIKey is PUFBXJPEBHVXHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F2I/c6-3-1-2-5(7)4-8/h5H,1-4H2.
What are the key properties of 2,5-difluoro-1-iodopentane?
2,5-difluoro-1-iodopentane has a molecular weight of 234.03 g/mol, XLogP of 2.51, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-difluoro-1-iodopentane is sourced from PubChem (CID 175232085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).