About 3-fluoro-5-propylnonane;methanamine
3-fluoro-5-propylnonane;methanamine (PubChem CID 168880819) has the molecular formula C13H30FN
and a molecular weight of 219.39 g/mol. Its IUPAC name is 3-fluoro-5-propylnonane;methanamine.
Molecular Properties
| Compound Name | 3-fluoro-5-propylnonane;methanamine |
| PubChem CID | 168880819 |
| Molecular Formula | C13H30FN |
| Molecular Weight | 219.39 g/mol |
| Exact Mass | 219.24 |
| IUPAC Name | 3-fluoro-5-propylnonane;methanamine |
| SMILES | CCCCC(CCC)CC(F)CC.CN |
| InChI | InChI=1S/C12H25F.CH5N/c1-4-7-9-11(8-5-2)10-12(13)6-3;1-2/h11-12H,4-10H2,1-3H3;2H2,1H3 |
| InChIKey | CCYQNNHJMBCYFY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-5-propylnonane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-5-propylnonane;methanamine?
The IUPAC name of 3-fluoro-5-propylnonane;methanamine (CID 168880819) is 3-fluoro-5-propylnonane;methanamine.
What is the SMILES notation for 3-fluoro-5-propylnonane;methanamine?
The canonical SMILES for 3-fluoro-5-propylnonane;methanamine is CCCCC(CCC)CC(F)CC.CN.
What is the InChIKey of 3-fluoro-5-propylnonane;methanamine?
The InChIKey is CCYQNNHJMBCYFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25F.CH5N/c1-4-7-9-11(8-5-2)10-12(13)6-3;1-2/h11-12H,4-10H2,1-3H3;2H2,1H3.
What are the key properties of 3-fluoro-5-propylnonane;methanamine?
3-fluoro-5-propylnonane;methanamine has a molecular weight of 219.39 g/mol, XLogP of 4.31, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-5-propylnonane;methanamine is sourced from PubChem (CID 168880819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).