About 3-fluoro-5-propyloctane
3-fluoro-5-propyloctane (PubChem CID 168880938) has the molecular formula C11H23F
and a molecular weight of 174.30 g/mol. Its IUPAC name is 3-fluoro-5-propyloctane.
Molecular Properties
| Compound Name | 3-fluoro-5-propyloctane |
| PubChem CID | 168880938 |
| Molecular Formula | C11H23F |
| Molecular Weight | 174.30 g/mol |
| Exact Mass | 174.18 |
| IUPAC Name | 3-fluoro-5-propyloctane |
| SMILES | CCCC(CCC)CC(F)CC |
| InChI | InChI=1S/C11H23F/c1-4-7-10(8-5-2)9-11(12)6-3/h10-11H,4-9H2,1-3H3 |
| InChIKey | YSLZAGQMDIGFFO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-fluoro-5-propyloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-5-propyloctane?
The IUPAC name of 3-fluoro-5-propyloctane (CID 168880938) is 3-fluoro-5-propyloctane.
What is the SMILES notation for 3-fluoro-5-propyloctane?
The canonical SMILES for 3-fluoro-5-propyloctane is CCCC(CCC)CC(F)CC.
What is the InChIKey of 3-fluoro-5-propyloctane?
The InChIKey is YSLZAGQMDIGFFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23F/c1-4-7-10(8-5-2)9-11(12)6-3/h10-11H,4-9H2,1-3H3.
What are the key properties of 3-fluoro-5-propyloctane?
3-fluoro-5-propyloctane has a molecular weight of 174.30 g/mol, XLogP of 4.34, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-5-propyloctane is sourced from PubChem (CID 168880938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).