About 3-ethyl-5-fluorooctane
3-ethyl-5-fluorooctane (PubChem CID 175589008) has the molecular formula C10H21F
and a molecular weight of 160.28 g/mol. Its IUPAC name is 3-ethyl-5-fluorooctane.
Molecular Properties
| Compound Name | 3-ethyl-5-fluorooctane |
| PubChem CID | 175589008 |
| Molecular Formula | C10H21F |
| Molecular Weight | 160.28 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | 3-ethyl-5-fluorooctane |
| SMILES | CCCC(F)CC(CC)CC |
| InChI | InChI=1S/C10H21F/c1-4-7-10(11)8-9(5-2)6-3/h9-10H,4-8H2,1-3H3 |
| InChIKey | AMBUAABRISBDTF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-ethyl-5-fluorooctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-fluorooctane?
The IUPAC name of 3-ethyl-5-fluorooctane (CID 175589008) is 3-ethyl-5-fluorooctane.
What is the SMILES notation for 3-ethyl-5-fluorooctane?
The canonical SMILES for 3-ethyl-5-fluorooctane is CCCC(F)CC(CC)CC.
What is the InChIKey of 3-ethyl-5-fluorooctane?
The InChIKey is AMBUAABRISBDTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21F/c1-4-7-10(11)8-9(5-2)6-3/h9-10H,4-8H2,1-3H3.
What are the key properties of 3-ethyl-5-fluorooctane?
3-ethyl-5-fluorooctane has a molecular weight of 160.28 g/mol, XLogP of 3.95, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-fluorooctane is sourced from PubChem (CID 175589008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).